C12H15F3N2O3S — CID 137152958
2-[2-[(2S)-oxan-2-yl]oxyethylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 137152958) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 2-[2-[(2S)-oxan-2-yl]oxyethylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[(2S)-oxan-2-yl]oxyethylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137152958 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[2-[(2S)-oxan-2-yl]oxyethylsulfanyl]-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(SCCO[C@H]2CCCCO2)[nH]1 |
| InChI | InChI=1S/C12H15F3N2O3S/c13-12(14,15)8-7-9(18)17-11(16-8)21-6-5-20-10-3-1-2-4-19-10/h7,10H,1-6H2,(H,16,17,18)/t10-/m0/s1 |
| InChIKey | DRBKPLXGSLVRFZ-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|