C17H19FN2O4 — CID 66826611
6-[4-fluoro-2-[2-(oxan-2-yloxy)ethyl]phenyl]-1H-pyrimidine-2,4-dione (PubChem CID 66826611) has the molecular formula C17H19FN2O4 and a molecular weight of 334.35 g/mol. Its IUPAC name is 6-[4-fluoro-2-[2-(oxan-2-yloxy)ethyl]phenyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[4-fluoro-2-[2-(oxan-2-yloxy)ethyl]phenyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66826611 |
| Molecular Formula | C17H19FN2O4 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 6-[4-fluoro-2-[2-(oxan-2-yloxy)ethyl]phenyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(-c2ccc(F)cc2CCOC2CCCCO2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C17H19FN2O4/c18-12-4-5-13(14-10-15(21)20-17(22)19-14)11(9-12)6-8-24-16-3-1-2-7-23-16/h4-5,9-10,16H,1-3,6-8H2,(H2,19,20,21,22) |
| InChIKey | YDQTWCVCCXQCGZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |