C11H14ClNO2 — CID 168944061
3-chloro-2-(oxan-2-yloxymethyl)pyridine (PubChem CID 168944061) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 3-chloro-2-(oxan-2-yloxymethyl)pyridine.
| Compound Name | 3-chloro-2-(oxan-2-yloxymethyl)pyridine |
|---|---|
| PubChem CID | 168944061 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-chloro-2-(oxan-2-yloxymethyl)pyridine |
| SMILES | Clc1cccnc1COC1CCCCO1 |
| InChI | InChI=1S/C11H14ClNO2/c12-9-4-3-6-13-10(9)8-15-11-5-1-2-7-14-11/h3-4,6,11H,1-2,5,7-8H2 |
| InChIKey | MHDBLLBHHFKXAV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |