C24H32N4O4 — CID 101178662
2,9-bis[2-(oxan-2-yloxy)ethyl]-2,4,9,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene (PubChem CID 101178662) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2,9-bis[2-(oxan-2-yloxy)ethyl]-2,4,9,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene.
| Compound Name | 2,9-bis[2-(oxan-2-yloxy)ethyl]-2,4,9,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 101178662 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2,9-bis[2-(oxan-2-yloxy)ethyl]-2,4,9,11-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
| SMILES | c1cnc2c(c1)N(CCOC1CCCCO1)c1ncccc1N2CCOC1CCCCO1 |
| InChI | InChI=1S/C24H32N4O4/c1-3-15-29-21(9-1)31-17-13-27-19-7-5-12-26-24(19)28(20-8-6-11-25-23(20)27)14-18-32-22-10-2-4-16-30-22/h5-8,11-12,21-22H,1-4,9-10,13-18H2 |
| InChIKey | IOYNPDZSOGDEMY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |