C22H25ClN2O4 — CID 166004335
4-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(oxan-2-yloxymethyl)benzaldehyde (PubChem CID 166004335) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is 4-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(oxan-2-yloxymethyl)benzaldehyde.
| Compound Name | 4-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(oxan-2-yloxymethyl)benzaldehyde |
|---|---|
| PubChem CID | 166004335 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(oxan-2-yloxymethyl)benzaldehyde |
| SMILES | O=Cc1ccc(N2CC[C@H](Oc3ncccc3Cl)C2)c(COC2CCCCO2)c1 |
| InChI | InChI=1S/C22H25ClN2O4/c23-19-4-3-9-24-22(19)29-18-8-10-25(13-18)20-7-6-16(14-26)12-17(20)15-28-21-5-1-2-11-27-21/h3-4,6-7,9,12,14,18,21H,1-2,5,8,10-11,13,15H2/t18-,21?/m0/s1 |
| InChIKey | OWOLQRAFXDUQPD-YMXDCFFPSA-N |
| XLogP | 4.25 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|