C23H18ClFN2O3 — CID 156815130
2-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-(4-fluorobenzoyl)benzaldehyde (PubChem CID 156815130) has the molecular formula C23H18ClFN2O3 and a molecular weight of 424.86 g/mol. Its IUPAC name is 2-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-(4-fluorobenzoyl)benzaldehyde.
| Compound Name | 2-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-(4-fluorobenzoyl)benzaldehyde |
|---|---|
| PubChem CID | 156815130 |
| Molecular Formula | C23H18ClFN2O3 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[(3S)-3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-5-(4-fluorobenzoyl)benzaldehyde |
| SMILES | O=Cc1cc(C(=O)c2ccc(F)cc2)ccc1N1CC[C@H](Oc2ncccc2Cl)C1 |
| InChI | InChI=1S/C23H18ClFN2O3/c24-20-2-1-10-26-23(20)30-19-9-11-27(13-19)21-8-5-16(12-17(21)14-28)22(29)15-3-6-18(25)7-4-15/h1-8,10,12,14,19H,9,11,13H2/t19-/m0/s1 |
| InChIKey | KNOADQWVXYCNRV-IBGZPJMESA-N |
| XLogP | 4.58 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|