C22H17Cl2N3O — CID 166004349
3-chloro-2-[(3S)-1-[4-(2-chlorophenyl)-2-isocyanophenyl]pyrrolidin-3-yl]oxypyridine (PubChem CID 166004349) has the molecular formula C22H17Cl2N3O and a molecular weight of 410.30 g/mol. Its IUPAC name is 3-chloro-2-[(3S)-1-[4-(2-chlorophenyl)-2-isocyanophenyl]pyrrolidin-3-yl]oxypyridine.
| Compound Name | 3-chloro-2-[(3S)-1-[4-(2-chlorophenyl)-2-isocyanophenyl]pyrrolidin-3-yl]oxypyridine |
|---|---|
| PubChem CID | 166004349 |
| Molecular Formula | C22H17Cl2N3O |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 3-chloro-2-[(3S)-1-[4-(2-chlorophenyl)-2-isocyanophenyl]pyrrolidin-3-yl]oxypyridine |
| SMILES | [C-]#[N+]c1cc(-c2ccccc2Cl)ccc1N1CC[C@H](Oc2ncccc2Cl)C1 |
| InChI | InChI=1S/C22H17Cl2N3O/c1-25-20-13-15(17-5-2-3-6-18(17)23)8-9-21(20)27-12-10-16(14-27)28-22-19(24)7-4-11-26-22/h2-9,11,13,16H,10,12,14H2/t16-/m0/s1 |
| InChIKey | GABGXUMILVSDPM-INIZCTEOSA-N |
| XLogP | 6.26 |
| TPSA | 29.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|