C22H20Cl2N2O3 — CID 170313502
[5-(3-chlorophenoxy)-2-[3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]phenyl]methanol (PubChem CID 170313502) has the molecular formula C22H20Cl2N2O3 and a molecular weight of 431.32 g/mol. Its IUPAC name is [5-(3-chlorophenoxy)-2-[3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]phenyl]methanol.
| Compound Name | [5-(3-chlorophenoxy)-2-[3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 170313502 |
| Molecular Formula | C22H20Cl2N2O3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [5-(3-chlorophenoxy)-2-[3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]phenyl]methanol |
| SMILES | OCc1cc(Oc2cccc(Cl)c2)ccc1N1CCC(Oc2ncccc2Cl)C1 |
| InChI | InChI=1S/C22H20Cl2N2O3/c23-16-3-1-4-17(12-16)28-18-6-7-21(15(11-18)14-27)26-10-8-19(13-26)29-22-20(24)5-2-9-25-22/h1-7,9,11-12,19,27H,8,10,13-14H2 |
| InChIKey | WEQVASXMYFZITB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |