C26H26ClN3O3 — CID 170313369
4-[3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(2-methoxyethenyl)-N-methyl-N-phenylbenzamide (PubChem CID 170313369) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is 4-[3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(2-methoxyethenyl)-N-methyl-N-phenylbenzamide.
| Compound Name | 4-[3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(2-methoxyethenyl)-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 170313369 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 4-[3-[(3-chloro-2-pyridinyl)oxy]pyrrolidin-1-yl]-3-(2-methoxyethenyl)-N-methyl-N-phenylbenzamide |
| SMILES | COC=Cc1cc(C(=O)N(C)c2ccccc2)ccc1N1CCC(Oc2ncccc2Cl)C1 |
| InChI | InChI=1S/C26H26ClN3O3/c1-29(21-7-4-3-5-8-21)26(31)20-10-11-24(19(17-20)13-16-32-2)30-15-12-22(18-30)33-25-23(27)9-6-14-28-25/h3-11,13-14,16-17,22H,12,15,18H2,1-2H3 |
| InChIKey | MYBMAHUMZHKPEG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|