C25H23ClFN3O2 — CID 166683283
(2-chlorophenyl)-[4-[3-[(5-fluoro-2-pyridinyl)amino]pyrrolidin-1-yl]-3-[(Z)-2-methoxyethenyl]phenyl]methanone (PubChem CID 166683283) has the molecular formula C25H23ClFN3O2 and a molecular weight of 451.93 g/mol. Its IUPAC name is (2-chlorophenyl)-[4-[3-[(5-fluoro-2-pyridinyl)amino]pyrrolidin-1-yl]-3-[(Z)-2-methoxyethenyl]phenyl]methanone.
| Compound Name | (2-chlorophenyl)-[4-[3-[(5-fluoro-2-pyridinyl)amino]pyrrolidin-1-yl]-3-[(Z)-2-methoxyethenyl]phenyl]methanone |
|---|---|
| PubChem CID | 166683283 |
| Molecular Formula | C25H23ClFN3O2 |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (2-chlorophenyl)-[4-[3-[(5-fluoro-2-pyridinyl)amino]pyrrolidin-1-yl]-3-[(Z)-2-methoxyethenyl]phenyl]methanone |
| SMILES | CO/C=C\c1cc(C(=O)c2ccccc2Cl)ccc1N1CCC(Nc2ccc(F)cn2)C1 |
| InChI | InChI=1S/C25H23ClFN3O2/c1-32-13-11-17-14-18(25(31)21-4-2-3-5-22(21)26)6-8-23(17)30-12-10-20(16-30)29-24-9-7-19(27)15-28-24/h2-9,11,13-15,20H,10,12,16H2,1H3,(H,28,29)/b13-11- |
| InChIKey | MEZDNVDOTOXUGF-QBFSEMIESA-N |
| XLogP | 5.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|