C24H21ClFN3O2 — CID 166004297
2-[5-(2-chlorobenzoyl)-2-[(3S)-3-[(5-fluoro-2-pyridinyl)amino]pyrrolidin-1-yl]phenyl]acetaldehyde (PubChem CID 166004297) has the molecular formula C24H21ClFN3O2 and a molecular weight of 437.90 g/mol. Its IUPAC name is 2-[5-(2-chlorobenzoyl)-2-[(3S)-3-[(5-fluoro-2-pyridinyl)amino]pyrrolidin-1-yl]phenyl]acetaldehyde.
| Compound Name | 2-[5-(2-chlorobenzoyl)-2-[(3S)-3-[(5-fluoro-2-pyridinyl)amino]pyrrolidin-1-yl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 166004297 |
| Molecular Formula | C24H21ClFN3O2 |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[5-(2-chlorobenzoyl)-2-[(3S)-3-[(5-fluoro-2-pyridinyl)amino]pyrrolidin-1-yl]phenyl]acetaldehyde |
| SMILES | O=CCc1cc(C(=O)c2ccccc2Cl)ccc1N1CC[C@H](Nc2ccc(F)cn2)C1 |
| InChI | InChI=1S/C24H21ClFN3O2/c25-21-4-2-1-3-20(21)24(31)17-5-7-22(16(13-17)10-12-30)29-11-9-19(15-29)28-23-8-6-18(26)14-27-23/h1-8,12-14,19H,9-11,15H2,(H,27,28)/t19-/m0/s1 |
| InChIKey | KAHXKFVIIMJSGD-IBGZPJMESA-N |
| XLogP | 4.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|