C19H18ClNO4 — CID 69124049
1-[5-(2-chlorophenyl)-3-(oxan-2-yloxymethyl)-1,2-oxazol-4-yl]but-2-yn-1-one (PubChem CID 69124049) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is 1-[5-(2-chlorophenyl)-3-(oxan-2-yloxymethyl)-1,2-oxazol-4-yl]but-2-yn-1-one.
| Compound Name | 1-[5-(2-chlorophenyl)-3-(oxan-2-yloxymethyl)-1,2-oxazol-4-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 69124049 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-[5-(2-chlorophenyl)-3-(oxan-2-yloxymethyl)-1,2-oxazol-4-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)c1c(COC2CCCCO2)noc1-c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClNO4/c1-2-7-16(22)18-15(12-24-17-10-5-6-11-23-17)21-25-19(18)13-8-3-4-9-14(13)20/h3-4,8-9,17H,5-6,10-12H2,1H3 |
| InChIKey | KCDYUUHWDHHHMY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|