C21H26O6 — CID 11153026
ethyl 1-(2-methoxy-2-oxoethyl)-3-(oxan-2-yloxymethyl)-1H-indene-2-carboxylate (PubChem CID 11153026) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is ethyl 1-(2-methoxy-2-oxoethyl)-3-(oxan-2-yloxymethyl)-1H-indene-2-carboxylate.
| Compound Name | ethyl 1-(2-methoxy-2-oxoethyl)-3-(oxan-2-yloxymethyl)-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 11153026 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | ethyl 1-(2-methoxy-2-oxoethyl)-3-(oxan-2-yloxymethyl)-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(COC2CCCCO2)c2ccccc2C1CC(=O)OC |
| InChI | InChI=1S/C21H26O6/c1-3-25-21(23)20-16(12-18(22)24-2)14-8-4-5-9-15(14)17(20)13-27-19-10-6-7-11-26-19/h4-5,8-9,16,19H,3,6-7,10-13H2,1-2H3 |
| InChIKey | KLBUOXHJQKFZMT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |