C19H20F3NO6 — CID 20749378
3-[hydroxy-[2-(2-methoxyethoxymethyl)-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]methylidene]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 20749378) has the molecular formula C19H20F3NO6 and a molecular weight of 415.36 g/mol. Its IUPAC name is 3-[hydroxy-[2-(2-methoxyethoxymethyl)-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]methylidene]bicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-[hydroxy-[2-(2-methoxyethoxymethyl)-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]methylidene]bicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 20749378 |
| Molecular Formula | C19H20F3NO6 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 3-[hydroxy-[2-(2-methoxyethoxymethyl)-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]methylidene]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | COCCOCc1c(C(O)=C2C(=O)C3CCC(C3)C2=O)ccc(C(F)(F)F)[n+]1[O-] |
| InChI | InChI=1S/C19H20F3NO6/c1-28-6-7-29-9-13-12(4-5-14(23(13)27)19(20,21)22)18(26)15-16(24)10-2-3-11(8-10)17(15)25/h4-5,10-11,26H,2-3,6-9H2,1H3 |
| InChIKey | RZSYOHVKGYVRBZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|