C14H12F3NO4 — CID 18755551
2-[hydroxy-[2-methyl-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]methylidene]cyclohexane-1,3-dione (PubChem CID 18755551) has the molecular formula C14H12F3NO4 and a molecular weight of 315.25 g/mol. Its IUPAC name is 2-[hydroxy-[2-methyl-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]methylidene]cyclohexane-1,3-dione.
| Compound Name | 2-[hydroxy-[2-methyl-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]methylidene]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 18755551 |
| Molecular Formula | C14H12F3NO4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[hydroxy-[2-methyl-1-oxido-6-(trifluoromethyl)pyridin-1-ium-3-yl]methylidene]cyclohexane-1,3-dione |
| SMILES | Cc1c(C(O)=C2C(=O)CCCC2=O)ccc(C(F)(F)F)[n+]1[O-] |
| InChI | InChI=1S/C14H12F3NO4/c1-7-8(5-6-11(18(7)22)14(15,16)17)13(21)12-9(19)3-2-4-10(12)20/h5-6,21H,2-4H2,1H3 |
| InChIKey | GCPNXCUOBYWIDM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|