C21H24F3NO7S — CID 58403532
2-[3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-6-ethylsulfonyl-2-(trifluoromethyl)phenoxy]-N-ethyl-N-methylacetamide (PubChem CID 58403532) has the molecular formula C21H24F3NO7S and a molecular weight of 491.48 g/mol. Its IUPAC name is 2-[3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-6-ethylsulfonyl-2-(trifluoromethyl)phenoxy]-N-ethyl-N-methylacetamide.
| Compound Name | 2-[3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-6-ethylsulfonyl-2-(trifluoromethyl)phenoxy]-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 58403532 |
| Molecular Formula | C21H24F3NO7S |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-[3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-6-ethylsulfonyl-2-(trifluoromethyl)phenoxy]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)COc1c(S(=O)(=O)CC)ccc(C(O)=C2C(=O)CCCC2=O)c1C(F)(F)F |
| InChI | InChI=1S/C21H24F3NO7S/c1-4-25(3)16(28)11-32-20-15(33(30,31)5-2)10-9-12(18(20)21(22,23)24)19(29)17-13(26)7-6-8-14(17)27/h9-10,29H,4-8,11H2,1-3H3 |
| InChIKey | DNEGDOWMLQHKSM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|