C19H18Cl2N2O4 — CID 155683166
2-[[2,4-dichloro-3-[(2,5-dimethylpyrazol-3-yl)oxymethyl]phenyl]-hydroxymethylidene]cyclohexane-1,3-dione (PubChem CID 155683166) has the molecular formula C19H18Cl2N2O4 and a molecular weight of 409.27 g/mol. Its IUPAC name is 2-[[2,4-dichloro-3-[(2,5-dimethylpyrazol-3-yl)oxymethyl]phenyl]-hydroxymethylidene]cyclohexane-1,3-dione.
| Compound Name | 2-[[2,4-dichloro-3-[(2,5-dimethylpyrazol-3-yl)oxymethyl]phenyl]-hydroxymethylidene]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 155683166 |
| Molecular Formula | C19H18Cl2N2O4 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-[[2,4-dichloro-3-[(2,5-dimethylpyrazol-3-yl)oxymethyl]phenyl]-hydroxymethylidene]cyclohexane-1,3-dione |
| SMILES | Cc1cc(OCc2c(Cl)ccc(C(O)=C3C(=O)CCCC3=O)c2Cl)n(C)n1 |
| InChI | InChI=1S/C19H18Cl2N2O4/c1-10-8-16(23(2)22-10)27-9-12-13(20)7-6-11(18(12)21)19(26)17-14(24)4-3-5-15(17)25/h6-8,26H,3-5,9H2,1-2H3 |
| InChIKey | CDSCSUOKSAZSJC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|