C18H18Cl2O2S2 — CID 139911846
3-chloro-2-(4-chloro-2-propylsulfanyl-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one (PubChem CID 139911846) has the molecular formula C18H18Cl2O2S2 and a molecular weight of 401.38 g/mol. Its IUPAC name is 3-chloro-2-(4-chloro-2-propylsulfanyl-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one.
| Compound Name | 3-chloro-2-(4-chloro-2-propylsulfanyl-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 139911846 |
| Molecular Formula | C18H18Cl2O2S2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 3-chloro-2-(4-chloro-2-propylsulfanyl-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one |
| SMILES | CCCSC1Cc2c(ccc(C(=O)C3=C(Cl)CCCC3=O)c2Cl)S1 |
| InChI | InChI=1S/C18H18Cl2O2S2/c1-2-8-23-15-9-11-14(24-15)7-6-10(17(11)20)18(22)16-12(19)4-3-5-13(16)21/h6-7,15H,2-5,8-9H2,1H3 |
| InChIKey | MYHOHTJDMYQKBV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|