C24H27ClO6S — CID 139896649
3-O-tert-butyl 1-O-ethyl 2-[2-(4-chloro-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-oxocyclohexen-1-yl]propanedioate (PubChem CID 139896649) has the molecular formula C24H27ClO6S and a molecular weight of 478.99 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-ethyl 2-[2-(4-chloro-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-oxocyclohexen-1-yl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-ethyl 2-[2-(4-chloro-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-oxocyclohexen-1-yl]propanedioate |
|---|---|
| PubChem CID | 139896649 |
| Molecular Formula | C24H27ClO6S |
| Molecular Weight | 478.99 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 3-O-tert-butyl 1-O-ethyl 2-[2-(4-chloro-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-oxocyclohexen-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OC(C)(C)C)C1=C(C(=O)c2ccc3c(c2Cl)CCS3)C(=O)CCC1 |
| InChI | InChI=1S/C24H27ClO6S/c1-5-30-22(28)19(23(29)31-24(2,3)4)14-7-6-8-16(26)18(14)21(27)15-9-10-17-13(20(15)25)11-12-32-17/h9-10,19H,5-8,11-12H2,1-4H3 |
| InChIKey | MDKHUIUUMKMVDW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.99 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|