C15H12BrClO4S — CID 20737411
3-bromo-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one (PubChem CID 20737411) has the molecular formula C15H12BrClO4S and a molecular weight of 403.68 g/mol. Its IUPAC name is 3-bromo-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one.
| Compound Name | 3-bromo-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 20737411 |
| Molecular Formula | C15H12BrClO4S |
| Molecular Weight | 403.68 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | 3-bromo-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one |
| SMILES | O=C1CCCC(Br)=C1C(=O)c1ccc2c(c1Cl)CCS2(=O)=O |
| InChI | InChI=1S/C15H12BrClO4S/c16-10-2-1-3-11(18)13(10)15(19)9-4-5-12-8(14(9)17)6-7-22(12,20)21/h4-5H,1-3,6-7H2 |
| InChIKey | KYYHVCAGISLKFS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.68 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|