C19H21ClO4S2 — CID 20737369
3-tert-butylsulfanyl-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one (PubChem CID 20737369) has the molecular formula C19H21ClO4S2 and a molecular weight of 412.96 g/mol. Its IUPAC name is 3-tert-butylsulfanyl-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one.
| Compound Name | 3-tert-butylsulfanyl-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 20737369 |
| Molecular Formula | C19H21ClO4S2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-tert-butylsulfanyl-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohex-2-en-1-one |
| SMILES | CC(C)(C)SC1=C(C(=O)c2ccc3c(c2Cl)CCS3(=O)=O)C(=O)CCC1 |
| InChI | InChI=1S/C19H21ClO4S2/c1-19(2,3)25-14-6-4-5-13(21)16(14)18(22)12-7-8-15-11(17(12)20)9-10-26(15,23)24/h7-8H,4-6,9-10H2,1-3H3 |
| InChIKey | HPYMOICKUYTPDO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|