C16H15ClO6S2 — CID 20737358
2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-methylsulfonylcyclohex-2-en-1-one (PubChem CID 20737358) has the molecular formula C16H15ClO6S2 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-methylsulfonylcyclohex-2-en-1-one.
| Compound Name | 2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-methylsulfonylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 20737358 |
| Molecular Formula | C16H15ClO6S2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-methylsulfonylcyclohex-2-en-1-one |
| SMILES | CS(=O)(=O)C1=C(C(=O)c2ccc3c(c2Cl)CCS3(=O)=O)C(=O)CCC1 |
| InChI | InChI=1S/C16H15ClO6S2/c1-24(20,21)13-4-2-3-11(18)14(13)16(19)10-5-6-12-9(15(10)17)7-8-25(12,22)23/h5-6H,2-4,7-8H2,1H3 |
| InChIKey | UWRUCUSIOICGAW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|