C18H19ClO3S2 — CID 139896618
2-(4-chloro-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-(1-hydroxypropylsulfanyl)cyclohex-2-en-1-one (PubChem CID 139896618) has the molecular formula C18H19ClO3S2 and a molecular weight of 382.93 g/mol. Its IUPAC name is 2-(4-chloro-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-(1-hydroxypropylsulfanyl)cyclohex-2-en-1-one.
| Compound Name | 2-(4-chloro-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-(1-hydroxypropylsulfanyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 139896618 |
| Molecular Formula | C18H19ClO3S2 |
| Molecular Weight | 382.93 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-(4-chloro-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-(1-hydroxypropylsulfanyl)cyclohex-2-en-1-one |
| SMILES | CCC(O)SC1=C(C(=O)c2ccc3c(c2Cl)CCS3)C(=O)CCC1 |
| InChI | InChI=1S/C18H19ClO3S2/c1-2-15(21)24-14-5-3-4-12(20)16(14)18(22)11-6-7-13-10(17(11)19)8-9-23-13/h6-7,15,21H,2-5,8-9H2,1H3 |
| InChIKey | ZOEMAQGMDYLBDH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|