C21H22Cl2O4S3 — CID 91439562
2-[2-(4-chloro-7-methyl-2-methylsulfanyl-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-oxocyclohexen-1-yl]sulfanylethyl 2-chloroacetate (PubChem CID 91439562) has the molecular formula C21H22Cl2O4S3 and a molecular weight of 505.51 g/mol. Its IUPAC name is 2-[2-(4-chloro-7-methyl-2-methylsulfanyl-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-oxocyclohexen-1-yl]sulfanylethyl 2-chloroacetate.
| Compound Name | 2-[2-(4-chloro-7-methyl-2-methylsulfanyl-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-oxocyclohexen-1-yl]sulfanylethyl 2-chloroacetate |
|---|---|
| PubChem CID | 91439562 |
| Molecular Formula | C21H22Cl2O4S3 |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | 2-[2-(4-chloro-7-methyl-2-methylsulfanyl-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-oxocyclohexen-1-yl]sulfanylethyl 2-chloroacetate |
| SMILES | CSC1Cc2c(Cl)c(C(=O)C3=C(SCCOC(=O)CCl)CCCC3=O)cc(C)c2S1 |
| InChI | InChI=1S/C21H22Cl2O4S3/c1-11-8-12(19(23)13-9-17(28-2)30-21(11)13)20(26)18-14(24)4-3-5-15(18)29-7-6-27-16(25)10-22/h8,17H,3-7,9-10H2,1-2H3 |
| InChIKey | FSISGWJRJFGMPM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|