C24H22ClN3O3S — CID 23403338
2-[[5-chloro-2-(6-oxo-2-phenylsulfanylcyclohexene-1-carbonyl)phenyl]methyl]-4,5-dimethyl-1,2,4-triazol-3-one (PubChem CID 23403338) has the molecular formula C24H22ClN3O3S and a molecular weight of 467.98 g/mol. Its IUPAC name is 2-[[5-chloro-2-(6-oxo-2-phenylsulfanylcyclohexene-1-carbonyl)phenyl]methyl]-4,5-dimethyl-1,2,4-triazol-3-one.
| Compound Name | 2-[[5-chloro-2-(6-oxo-2-phenylsulfanylcyclohexene-1-carbonyl)phenyl]methyl]-4,5-dimethyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 23403338 |
| Molecular Formula | C24H22ClN3O3S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[[5-chloro-2-(6-oxo-2-phenylsulfanylcyclohexene-1-carbonyl)phenyl]methyl]-4,5-dimethyl-1,2,4-triazol-3-one |
| SMILES | Cc1nn(Cc2cc(Cl)ccc2C(=O)C2=C(Sc3ccccc3)CCCC2=O)c(=O)n1C |
| InChI | InChI=1S/C24H22ClN3O3S/c1-15-26-28(24(31)27(15)2)14-16-13-17(25)11-12-19(16)23(30)22-20(29)9-6-10-21(22)32-18-7-4-3-5-8-18/h3-5,7-8,11-13H,6,9-10,14H2,1-2H3 |
| InChIKey | KSRAGJHFPCBYEU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|