C21H18OS — CID 175329078
(2,3-dimethyl-4-phenylsulfanylphenyl)-phenylmethanone (PubChem CID 175329078) has the molecular formula C21H18OS and a molecular weight of 318.44 g/mol. Its IUPAC name is (2,3-dimethyl-4-phenylsulfanylphenyl)-phenylmethanone.
| Compound Name | (2,3-dimethyl-4-phenylsulfanylphenyl)-phenylmethanone |
|---|---|
| PubChem CID | 175329078 |
| Molecular Formula | C21H18OS |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (2,3-dimethyl-4-phenylsulfanylphenyl)-phenylmethanone |
| SMILES | Cc1c(Sc2ccccc2)ccc(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H18OS/c1-15-16(2)20(23-18-11-7-4-8-12-18)14-13-19(15)21(22)17-9-5-3-6-10-17/h3-14H,1-2H3 |
| InChIKey | DLTKJTOYKMPBIO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |