C14H13HgS — CID 59905414
(2,6-dimethyl-3-phenylsulfanylphenyl)mercury (PubChem CID 59905414) has the molecular formula C14H13HgS and a molecular weight of 413.92 g/mol. Its IUPAC name is (2,6-dimethyl-3-phenylsulfanylphenyl)mercury.
| Compound Name | (2,6-dimethyl-3-phenylsulfanylphenyl)mercury |
|---|---|
| PubChem CID | 59905414 |
| Molecular Formula | C14H13HgS |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | (2,6-dimethyl-3-phenylsulfanylphenyl)mercury |
| SMILES | Cc1ccc(Sc2ccccc2)c(C)c1[Hg] |
| InChI | InChI=1S/C14H13S.Hg/c1-11-8-9-14(12(2)10-11)15-13-6-4-3-5-7-13;/h3-9H,1-2H3; |
| InChIKey | ZJCPOPXMOHGILD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|