C18H18ClN3O4 — CID 22272288
2-[4-chloro-2-[(3,4-dimethyl-5-oxo-1,2,4-triazol-1-yl)methyl]benzoyl]cyclohexane-1,3-dione (PubChem CID 22272288) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is 2-[4-chloro-2-[(3,4-dimethyl-5-oxo-1,2,4-triazol-1-yl)methyl]benzoyl]cyclohexane-1,3-dione.
| Compound Name | 2-[4-chloro-2-[(3,4-dimethyl-5-oxo-1,2,4-triazol-1-yl)methyl]benzoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 22272288 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[4-chloro-2-[(3,4-dimethyl-5-oxo-1,2,4-triazol-1-yl)methyl]benzoyl]cyclohexane-1,3-dione |
| SMILES | Cc1nn(Cc2cc(Cl)ccc2C(=O)C2C(=O)CCCC2=O)c(=O)n1C |
| InChI | InChI=1S/C18H18ClN3O4/c1-10-20-22(18(26)21(10)2)9-11-8-12(19)6-7-13(11)17(25)16-14(23)4-3-5-15(16)24/h6-8,16H,3-5,9H2,1-2H3 |
| InChIKey | FXLXADRANSDWTA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|