C12H8Cl2O3S — CID 14072889
4-(2,4-dichlorobenzoyl)thiane-3,5-dione (PubChem CID 14072889) has the molecular formula C12H8Cl2O3S and a molecular weight of 303.17 g/mol. Its IUPAC name is 4-(2,4-dichlorobenzoyl)thiane-3,5-dione.
| Compound Name | 4-(2,4-dichlorobenzoyl)thiane-3,5-dione |
|---|---|
| PubChem CID | 14072889 |
| Molecular Formula | C12H8Cl2O3S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 4-(2,4-dichlorobenzoyl)thiane-3,5-dione |
| SMILES | O=C1CSCC(=O)C1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl2O3S/c13-6-1-2-7(8(14)3-6)12(17)11-9(15)4-18-5-10(11)16/h1-3,11H,4-5H2 |
| InChIKey | CMUCCHCIIQPNFW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|