C12H7Cl2NO3 — CID 19417352
3-(2,4-dichlorobenzoyl)-1H-pyridine-2,4-dione (PubChem CID 19417352) has the molecular formula C12H7Cl2NO3 and a molecular weight of 284.10 g/mol. Its IUPAC name is 3-(2,4-dichlorobenzoyl)-1H-pyridine-2,4-dione.
| Compound Name | 3-(2,4-dichlorobenzoyl)-1H-pyridine-2,4-dione |
|---|---|
| PubChem CID | 19417352 |
| Molecular Formula | C12H7Cl2NO3 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 3-(2,4-dichlorobenzoyl)-1H-pyridine-2,4-dione |
| SMILES | O=C1C=CNC(=O)C1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl2NO3/c13-6-1-2-7(8(14)5-6)11(17)10-9(16)3-4-15-12(10)18/h1-5,10H,(H,15,18) |
| InChIKey | XZWVPVLBXBGPFG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|