C15H14Cl2O3 — CID 14749824
2-(2,4-dichlorobenzoyl)-4,6-dimethylcyclohexane-1,3-dione (PubChem CID 14749824) has the molecular formula C15H14Cl2O3 and a molecular weight of 313.18 g/mol. Its IUPAC name is 2-(2,4-dichlorobenzoyl)-4,6-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-(2,4-dichlorobenzoyl)-4,6-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 14749824 |
| Molecular Formula | C15H14Cl2O3 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-(2,4-dichlorobenzoyl)-4,6-dimethylcyclohexane-1,3-dione |
| SMILES | CC1CC(C)C(=O)C(C(=O)c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C15H14Cl2O3/c1-7-5-8(2)14(19)12(13(7)18)15(20)10-4-3-9(16)6-11(10)17/h3-4,6-8,12H,5H2,1-2H3 |
| InChIKey | DFPOFZGPFJXSDH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|