C14H18Cl2N2O — CID 110662344
(2,4-dichlorophenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone (PubChem CID 110662344) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 110662344 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (2,4-dichlorophenyl)-(3,4,5-trimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(Cl)cc2Cl)CC(C)N1C |
| InChI | InChI=1S/C14H18Cl2N2O/c1-9-7-18(8-10(2)17(9)3)14(19)12-5-4-11(15)6-13(12)16/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | HHUKIIZVYBZZPK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |