C16H21Cl2NO — CID 114594194
1-(2,4-dichlorophenyl)-2-(2,3,5-trimethylpiperidin-1-yl)ethanone (PubChem CID 114594194) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(2,3,5-trimethylpiperidin-1-yl)ethanone.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(2,3,5-trimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 114594194 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(2,3,5-trimethylpiperidin-1-yl)ethanone |
| SMILES | CC1CC(C)C(C)N(CC(=O)c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H21Cl2NO/c1-10-6-11(2)12(3)19(8-10)9-16(20)14-5-4-13(17)7-15(14)18/h4-5,7,10-12H,6,8-9H2,1-3H3 |
| InChIKey | RDANMKQXHOSQKW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |