About 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one
3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one (PubChem CID 142271784) has the molecular formula C16H15Cl3O3
and a molecular weight of 361.65 g/mol. Its IUPAC name is 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one |
| PubChem CID | 142271784 |
| Molecular Formula | C16H15Cl3O3 |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one |
| SMILES | CCCOc1c(Cl)ccc(C(=O)C2=C(Cl)CCCC2=O)c1Cl |
| InChI | InChI=1S/C16H15Cl3O3/c1-2-8-22-16-11(18)7-6-9(14(16)19)15(21)13-10(17)4-3-5-12(13)20/h6-7H,2-5,8H2,1H3 |
| InChIKey | XOXYVVNWBYBJAQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one?
The IUPAC name of 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one (CID 142271784) is 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one.
What is the SMILES notation for 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one?
The canonical SMILES for 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one is CCCOc1c(Cl)ccc(C(=O)C2=C(Cl)CCCC2=O)c1Cl.
What is the InChIKey of 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one?
The InChIKey is XOXYVVNWBYBJAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl3O3/c1-2-8-22-16-11(18)7-6-9(14(16)19)15(21)13-10(17)4-3-5-12(13)20/h6-7H,2-5,8H2,1H3.
What are the key properties of 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one?
3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one has a molecular weight of 361.65 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-(2,4-dichloro-3-propoxybenzoyl)cyclohex-2-en-1-one is sourced from PubChem (CID 142271784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).