C9H6Cl4O2 — CID 12056776
2,4-dichloro-3-(2-chloroethoxy)benzoyl chloride (PubChem CID 12056776) has the molecular formula C9H6Cl4O2 and a molecular weight of 287.96 g/mol. Its IUPAC name is 2,4-dichloro-3-(2-chloroethoxy)benzoyl chloride.
| Compound Name | 2,4-dichloro-3-(2-chloroethoxy)benzoyl chloride |
|---|---|
| PubChem CID | 12056776 |
| Molecular Formula | C9H6Cl4O2 |
| Molecular Weight | 287.96 g/mol |
| Exact Mass | 285.91 |
| IUPAC Name | 2,4-dichloro-3-(2-chloroethoxy)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(Cl)c(OCCCl)c1Cl |
| InChI | InChI=1S/C9H6Cl4O2/c10-3-4-15-8-6(11)2-1-5(7(8)12)9(13)14/h1-2H,3-4H2 |
| InChIKey | QJLUDOMZNYGVFK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|