C11H9Cl3N4O2S — CID 87999782
2,4-dichloro-3-[2-(5-methylsulfanyltetrazol-2-yl)ethoxy]benzoyl chloride (PubChem CID 87999782) has the molecular formula C11H9Cl3N4O2S and a molecular weight of 367.65 g/mol. Its IUPAC name is 2,4-dichloro-3-[2-(5-methylsulfanyltetrazol-2-yl)ethoxy]benzoyl chloride.
| Compound Name | 2,4-dichloro-3-[2-(5-methylsulfanyltetrazol-2-yl)ethoxy]benzoyl chloride |
|---|---|
| PubChem CID | 87999782 |
| Molecular Formula | C11H9Cl3N4O2S |
| Molecular Weight | 367.65 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 2,4-dichloro-3-[2-(5-methylsulfanyltetrazol-2-yl)ethoxy]benzoyl chloride |
| SMILES | CSc1nnn(CCOc2c(Cl)ccc(C(=O)Cl)c2Cl)n1 |
| InChI | InChI=1S/C11H9Cl3N4O2S/c1-21-11-15-17-18(16-11)4-5-20-9-7(12)3-2-6(8(9)13)10(14)19/h2-3H,4-5H2,1H3 |
| InChIKey | QUTTXEBVBHAATH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.65 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|