About 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide
4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide (PubChem CID 8996445) has the molecular formula C16H13Cl2N5O2
and a molecular weight of 378.22 g/mol. Its IUPAC name is 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide.
Molecular Properties
| Compound Name | 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide |
| PubChem CID | 8996445 |
| Molecular Formula | C16H13Cl2N5O2 |
| Molecular Weight | 378.22 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2nnn(CCOc3c(Cl)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C16H13Cl2N5O2/c17-12-2-1-3-13(18)14(12)25-9-8-23-21-16(20-22-23)11-6-4-10(5-7-11)15(19)24/h1-7H,8-9H2,(H2,19,24) |
| InChIKey | CDYVDWWLFWCHQA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide?
The IUPAC name of 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide (CID 8996445) is 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide.
What is the SMILES notation for 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide?
The canonical SMILES for 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide is NC(=O)c1ccc(-c2nnn(CCOc3c(Cl)cccc3Cl)n2)cc1.
What is the InChIKey of 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide?
The InChIKey is CDYVDWWLFWCHQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2N5O2/c17-12-2-1-3-13(18)14(12)25-9-8-23-21-16(20-22-23)11-6-4-10(5-7-11)15(19)24/h1-7H,8-9H2,(H2,19,24).
What are the key properties of 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide?
4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide has a molecular weight of 378.22 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-(2,6-dichlorophenoxy)ethyl]tetrazol-5-yl]benzamide is sourced from PubChem (CID 8996445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).