About (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate
(3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate (PubChem CID 4917938) has the molecular formula C22H16Cl2N4O2
and a molecular weight of 439.30 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate |
| PubChem CID | 4917938 |
| Molecular Formula | C22H16Cl2N4O2 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate |
| SMILES | O=C(OCc1cccc(Cl)c1)c1ccc(-c2nnn(Cc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C22H16Cl2N4O2/c23-19-5-1-3-15(11-19)13-28-26-21(25-27-28)17-7-9-18(10-8-17)22(29)30-14-16-4-2-6-20(24)12-16/h1-12H,13-14H2 |
| InChIKey | FXXZHAJMBFISIL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate?
The IUPAC name of (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate (CID 4917938) is (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate.
What is the SMILES notation for (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate?
The canonical SMILES for (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate is O=C(OCc1cccc(Cl)c1)c1ccc(-c2nnn(Cc3cccc(Cl)c3)n2)cc1.
What is the InChIKey of (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate?
The InChIKey is FXXZHAJMBFISIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Cl2N4O2/c23-19-5-1-3-15(11-19)13-28-26-21(25-27-28)17-7-9-18(10-8-17)22(29)30-14-16-4-2-6-20(24)12-16/h1-12H,13-14H2.
What are the key properties of (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate?
(3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate has a molecular weight of 439.30 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl 4-[2-[(3-chlorophenyl)methyl]tetrazol-5-yl]benzoate is sourced from PubChem (CID 4917938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).