C18H18Cl2N4O — CID 3166741
5-(4-butoxyphenyl)-2-[(2,6-dichlorophenyl)methyl]tetrazole (PubChem CID 3166741) has the molecular formula C18H18Cl2N4O and a molecular weight of 377.28 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-2-[(2,6-dichlorophenyl)methyl]tetrazole.
| Compound Name | 5-(4-butoxyphenyl)-2-[(2,6-dichlorophenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 3166741 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 5-(4-butoxyphenyl)-2-[(2,6-dichlorophenyl)methyl]tetrazole |
| SMILES | CCCCOc1ccc(-c2nnn(Cc3c(Cl)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C18H18Cl2N4O/c1-2-3-11-25-14-9-7-13(8-10-14)18-21-23-24(22-18)12-15-16(19)5-4-6-17(15)20/h4-10H,2-3,11-12H2,1H3 |
| InChIKey | GEAXCMPRNGNKFW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|