C22H25N5O2 — CID 3136446
2-[5-(4-butoxyphenyl)tetrazol-2-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 3136446) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 3136446 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | CCCCOc1ccc(-c2nnn(CC(=O)N3CCCc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C22H25N5O2/c1-2-3-15-29-19-12-10-18(11-13-19)22-23-25-27(24-22)16-21(28)26-14-6-8-17-7-4-5-9-20(17)26/h4-5,7,9-13H,2-3,6,8,14-16H2,1H3 |
| InChIKey | OECNEYFSCSZWRV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|