C19H19Cl2N5O2 — CID 3136442
2-[5-(4-butoxyphenyl)tetrazol-2-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 3136442) has the molecular formula C19H19Cl2N5O2 and a molecular weight of 420.30 g/mol. Its IUPAC name is 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 3136442 |
| Molecular Formula | C19H19Cl2N5O2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | CCCCOc1ccc(-c2nnn(CC(=O)Nc3ccc(Cl)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C19H19Cl2N5O2/c1-2-3-10-28-15-7-4-13(5-8-15)19-23-25-26(24-19)12-18(27)22-14-6-9-16(20)17(21)11-14/h4-9,11H,2-3,10,12H2,1H3,(H,22,27) |
| InChIKey | XOVHQAFTCAJURC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|