C20H22N6O5 — CID 3166714
2-[5-(4-butoxyphenyl)tetrazol-2-yl]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 3166714) has the molecular formula C20H22N6O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3166714 |
| Molecular Formula | C20H22N6O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[5-(4-butoxyphenyl)tetrazol-2-yl]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | CCCCOc1ccc(-c2nnn(CC(=O)Nc3ccc(OC)cc3[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C20H22N6O5/c1-3-4-11-31-15-7-5-14(6-8-15)20-22-24-25(23-20)13-19(27)21-17-10-9-16(30-2)12-18(17)26(28)29/h5-10,12H,3-4,11,13H2,1-2H3,(H,21,27) |
| InChIKey | OJERFWXPSIBWCV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|