C16H13F2N5O2 — CID 94386508
4-[2-[(2R)-2-(2,6-difluorophenyl)-2-hydroxyethyl]tetrazol-5-yl]benzamide (PubChem CID 94386508) has the molecular formula C16H13F2N5O2 and a molecular weight of 345.31 g/mol. Its IUPAC name is 4-[2-[(2R)-2-(2,6-difluorophenyl)-2-hydroxyethyl]tetrazol-5-yl]benzamide.
| Compound Name | 4-[2-[(2R)-2-(2,6-difluorophenyl)-2-hydroxyethyl]tetrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 94386508 |
| Molecular Formula | C16H13F2N5O2 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-[2-[(2R)-2-(2,6-difluorophenyl)-2-hydroxyethyl]tetrazol-5-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2nnn(C[C@H](O)c3c(F)cccc3F)n2)cc1 |
| InChI | InChI=1S/C16H13F2N5O2/c17-11-2-1-3-12(18)14(11)13(24)8-23-21-16(20-22-23)10-6-4-9(5-7-10)15(19)25/h1-7,13,24H,8H2,(H2,19,25)/t13-/m0/s1 |
| InChIKey | NAECXAOIJNGIEO-ZDUSSCGKSA-N |
| XLogP | 1.45 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |