C16H17N5O4 — CID 30749496
4-[2-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]tetrazol-5-yl]benzamide (PubChem CID 30749496) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is 4-[2-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]tetrazol-5-yl]benzamide.
| Compound Name | 4-[2-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]tetrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 30749496 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[2-[(2S)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]tetrazol-5-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2nnn(C[C@H](O)COCc3ccco3)n2)cc1 |
| InChI | InChI=1S/C16H17N5O4/c17-15(23)11-3-5-12(6-4-11)16-18-20-21(19-16)8-13(22)9-24-10-14-2-1-7-25-14/h1-7,13,22H,8-10H2,(H2,17,23)/t13-/m0/s1 |
| InChIKey | GMBJNQQIMCSLDJ-ZDUSSCGKSA-N |
| XLogP | 0.61 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |