C17H16Cl2N4O2 — CID 32556840
(2S)-1-[(4-chlorophenyl)methoxy]-3-[5-(4-chlorophenyl)tetrazol-2-yl]propan-2-ol (PubChem CID 32556840) has the molecular formula C17H16Cl2N4O2 and a molecular weight of 379.25 g/mol. Its IUPAC name is (2S)-1-[(4-chlorophenyl)methoxy]-3-[5-(4-chlorophenyl)tetrazol-2-yl]propan-2-ol.
| Compound Name | (2S)-1-[(4-chlorophenyl)methoxy]-3-[5-(4-chlorophenyl)tetrazol-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 32556840 |
| Molecular Formula | C17H16Cl2N4O2 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2S)-1-[(4-chlorophenyl)methoxy]-3-[5-(4-chlorophenyl)tetrazol-2-yl]propan-2-ol |
| SMILES | O[C@H](COCc1ccc(Cl)cc1)Cn1nnc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H16Cl2N4O2/c18-14-5-1-12(2-6-14)10-25-11-16(24)9-23-21-17(20-22-23)13-3-7-15(19)8-4-13/h1-8,16,24H,9-11H2/t16-/m0/s1 |
| InChIKey | NCCHTXQOKGSQDT-INIZCTEOSA-N |
| XLogP | 3.22 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |