methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate

C11H10F2N4O2 — CID 71999533

IUPACmethyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate
SMILESCOC(=O)c1ccc(-c2nnn(CC(F)F)n2)cc1
InChIInChI=1S/C11H10F2N4O2/c1-19-11(18)8-4-2-7(3-5-8)10-14-16-17(15-10)6-9(12)13/h2-5,9H,6H2,1H3
InChIKeyJCJPYNACENDBNJ-UHFFFAOYSA-N
MW268.22 g/mol
LogP1.39
Rot. Bonds4

About methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate

methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate (PubChem CID 71999533) has the molecular formula C11H10F2N4O2 and a molecular weight of 268.22 g/mol. Its IUPAC name is methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate.

Molecular Properties

Compound Namemethyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate
PubChem CID71999533
Molecular FormulaC11H10F2N4O2
Molecular Weight268.22 g/mol
Exact Mass268.08
IUPAC Namemethyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate
SMILESCOC(=O)c1ccc(-c2nnn(CC(F)F)n2)cc1
InChIInChI=1S/C11H10F2N4O2/c1-19-11(18)8-4-2-7(3-5-8)10-14-16-17(15-10)6-9(12)13/h2-5,9H,6H2,1H3
InChIKeyJCJPYNACENDBNJ-UHFFFAOYSA-N
XLogP1.39
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.22
LogP ≤ 51.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate?
The IUPAC name of methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate (CID 71999533) is methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate.
What is the SMILES notation for methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate?
The canonical SMILES for methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate is COC(=O)c1ccc(-c2nnn(CC(F)F)n2)cc1.
What is the InChIKey of methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate?
The InChIKey is JCJPYNACENDBNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N4O2/c1-19-11(18)8-4-2-7(3-5-8)10-14-16-17(15-10)6-9(12)13/h2-5,9H,6H2,1H3.
What are the key properties of methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate?
methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate has a molecular weight of 268.22 g/mol, XLogP of 1.39, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(2,2-difluoroethyl)tetrazol-5-yl]benzoate is sourced from PubChem (CID 71999533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).