C27H23N9O6 — CID 160736159
4-[[5-(furan-2-yl)tetrazol-2-yl]methyl]-N-hydroxybenzamide;methyl 4-[[5-(furan-2-yl)tetrazol-2-yl]methyl]benzoate (PubChem CID 160736159) has the molecular formula C27H23N9O6 and a molecular weight of 569.54 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)tetrazol-2-yl]methyl]-N-hydroxybenzamide;methyl 4-[[5-(furan-2-yl)tetrazol-2-yl]methyl]benzoate.
| Compound Name | 4-[[5-(furan-2-yl)tetrazol-2-yl]methyl]-N-hydroxybenzamide;methyl 4-[[5-(furan-2-yl)tetrazol-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 160736159 |
| Molecular Formula | C27H23N9O6 |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 4-[[5-(furan-2-yl)tetrazol-2-yl]methyl]-N-hydroxybenzamide;methyl 4-[[5-(furan-2-yl)tetrazol-2-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2nnc(-c3ccco3)n2)cc1.O=C(NO)c1ccc(Cn2nnc(-c3ccco3)n2)cc1 |
| InChI | InChI=1S/C14H12N4O3.C13H11N5O3/c1-20-14(19)11-6-4-10(5-7-11)9-18-16-13(15-17-18)12-3-2-8-21-12;19-13(16-20)10-5-3-9(4-6-10)8-18-15-12(14-17-18)11-2-1-7-21-11/h2-8H,9H2,1H3;1-7,20H,8H2,(H,16,19) |
| InChIKey | RUZAHMVVXUYPOH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 189.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|