C17H13N5O2S — CID 135358774
4-[[5-(1-benzothiophen-3-yl)tetrazol-2-yl]methyl]-N-hydroxybenzamide (PubChem CID 135358774) has the molecular formula C17H13N5O2S and a molecular weight of 351.39 g/mol. Its IUPAC name is 4-[[5-(1-benzothiophen-3-yl)tetrazol-2-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[5-(1-benzothiophen-3-yl)tetrazol-2-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 135358774 |
| Molecular Formula | C17H13N5O2S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-[[5-(1-benzothiophen-3-yl)tetrazol-2-yl]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(Cn2nnc(-c3csc4ccccc34)n2)cc1 |
| InChI | InChI=1S/C17H13N5O2S/c23-17(20-24)12-7-5-11(6-8-12)9-22-19-16(18-21-22)14-10-25-15-4-2-1-3-13(14)15/h1-8,10,24H,9H2,(H,20,23) |
| InChIKey | HRHPYDMAIAATJY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|