C11H10N6O2S — CID 63641279
3-[[5-(furan-2-yl)tetrazol-2-yl]methyl]thiophene-2-carbohydrazide (PubChem CID 63641279) has the molecular formula C11H10N6O2S and a molecular weight of 290.31 g/mol. Its IUPAC name is 3-[[5-(furan-2-yl)tetrazol-2-yl]methyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[[5-(furan-2-yl)tetrazol-2-yl]methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63641279 |
| Molecular Formula | C11H10N6O2S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3-[[5-(furan-2-yl)tetrazol-2-yl]methyl]thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1Cn1nnc(-c2ccco2)n1 |
| InChI | InChI=1S/C11H10N6O2S/c12-13-11(18)9-7(3-5-20-9)6-17-15-10(14-16-17)8-2-1-4-19-8/h1-5H,6,12H2,(H,13,18) |
| InChIKey | VOMWBNAMBXKYAB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|