C10H7Cl3N4O — CID 57437246
2,4-dichloro-3-[(5-methyltetrazol-2-yl)methyl]benzoyl chloride (PubChem CID 57437246) has the molecular formula C10H7Cl3N4O and a molecular weight of 305.55 g/mol. Its IUPAC name is 2,4-dichloro-3-[(5-methyltetrazol-2-yl)methyl]benzoyl chloride.
| Compound Name | 2,4-dichloro-3-[(5-methyltetrazol-2-yl)methyl]benzoyl chloride |
|---|---|
| PubChem CID | 57437246 |
| Molecular Formula | C10H7Cl3N4O |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 2,4-dichloro-3-[(5-methyltetrazol-2-yl)methyl]benzoyl chloride |
| SMILES | Cc1nnn(Cc2c(Cl)ccc(C(=O)Cl)c2Cl)n1 |
| InChI | InChI=1S/C10H7Cl3N4O/c1-5-14-16-17(15-5)4-7-8(11)3-2-6(9(7)12)10(13)18/h2-3H,4H2,1H3 |
| InChIKey | XHJCRIYYBFGHMY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|